About 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol
5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol (PubChem CID 83161653) has the molecular formula C11H22O2S
and a molecular weight of 218.36 g/mol. Its IUPAC name is 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol.
Molecular Properties
| Compound Name | 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol |
| PubChem CID | 83161653 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol |
| SMILES | CC(C)CCCC(O)C1CSCCO1 |
| InChI | InChI=1S/C11H22O2S/c1-9(2)4-3-5-10(12)11-8-14-7-6-13-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | WXIVMSGVFYVAHT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol?
The IUPAC name of 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol (CID 83161653) is 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol.
What is the SMILES notation for 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol?
The canonical SMILES for 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol is CC(C)CCCC(O)C1CSCCO1.
What is the InChIKey of 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol?
The InChIKey is WXIVMSGVFYVAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2S/c1-9(2)4-3-5-10(12)11-8-14-7-6-13-11/h9-12H,3-8H2,1-2H3.
What are the key properties of 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol?
5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol has a molecular weight of 218.36 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(1,4-oxathian-2-yl)hexan-1-ol is sourced from PubChem (CID 83161653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).