About 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide
1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 83162381) has the molecular formula C10H17N3O4S
and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide |
| PubChem CID | 83162381 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | CC(C)CCCn1cc(S(N)(=O)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H17N3O4S/c1-7(2)4-3-5-13-6-8(18(11,16)17)9(14)12-10(13)15/h6-7H,3-5H2,1-2H3,(H2,11,16,17)(H,12,14,15) |
| InChIKey | QLGQSPNCHOFTSS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide?
The IUPAC name of 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide (CID 83162381) is 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide.
What is the SMILES notation for 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide?
The canonical SMILES for 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide is CC(C)CCCn1cc(S(N)(=O)=O)c(=O)[nH]c1=O.
What is the InChIKey of 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide?
The InChIKey is QLGQSPNCHOFTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4S/c1-7(2)4-3-5-13-6-8(18(11,16)17)9(14)12-10(13)15/h6-7H,3-5H2,1-2H3,(H2,11,16,17)(H,12,14,15).
What are the key properties of 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide?
1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide has a molecular weight of 275.33 g/mol, XLogP of -0.38, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpentyl)-2,4-dioxopyrimidine-5-sulfonamide is sourced from PubChem (CID 83162381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).