About 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline
7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline (PubChem CID 83163580) has the molecular formula C11H6FN5O2
and a molecular weight of 259.20 g/mol. Its IUPAC name is 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline.
Molecular Properties
| Compound Name | 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline |
| PubChem CID | 83163580 |
| Molecular Formula | C11H6FN5O2 |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline |
| SMILES | O=[N+]([O-])c1cc(F)c(-n2cncn2)c2ncccc12 |
| InChI | InChI=1S/C11H6FN5O2/c12-8-4-9(17(18)19)7-2-1-3-14-10(7)11(8)16-6-13-5-15-16/h1-6H |
| InChIKey | ZBNSHECDVJIMSH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline?
The IUPAC name of 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline (CID 83163580) is 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline.
What is the SMILES notation for 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline?
The canonical SMILES for 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline is O=[N+]([O-])c1cc(F)c(-n2cncn2)c2ncccc12.
What is the InChIKey of 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline?
The InChIKey is ZBNSHECDVJIMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6FN5O2/c12-8-4-9(17(18)19)7-2-1-3-14-10(7)11(8)16-6-13-5-15-16/h1-6H.
What are the key properties of 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline?
7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline has a molecular weight of 259.20 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-5-nitro-8-(1,2,4-triazol-1-yl)quinoline is sourced from PubChem (CID 83163580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).