C13H12FN3O2S — CID 83164303
8-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7-fluoroquinoline-5,8-diamine (PubChem CID 83164303) has the molecular formula C13H12FN3O2S and a molecular weight of 293.32 g/mol. Its IUPAC name is 8-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7-fluoroquinoline-5,8-diamine.
| Compound Name | 8-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7-fluoroquinoline-5,8-diamine |
|---|---|
| PubChem CID | 83164303 |
| Molecular Formula | C13H12FN3O2S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 8-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7-fluoroquinoline-5,8-diamine |
| SMILES | Nc1cc(F)c(NC2C=CS(=O)(=O)C2)c2ncccc12 |
| InChI | InChI=1S/C13H12FN3O2S/c14-10-6-11(15)9-2-1-4-16-12(9)13(10)17-8-3-5-20(18,19)7-8/h1-6,8,17H,7,15H2 |
| InChIKey | QMPFQFBWBOAKBY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|