C14H14FN3O3 — CID 83164690
[1-(7-fluoro-5-nitroquinolin-8-yl)pyrrolidin-3-yl]methanol (PubChem CID 83164690) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is [1-(7-fluoro-5-nitroquinolin-8-yl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(7-fluoro-5-nitroquinolin-8-yl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 83164690 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [1-(7-fluoro-5-nitroquinolin-8-yl)pyrrolidin-3-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(F)c(N2CCC(CO)C2)c2ncccc12 |
| InChI | InChI=1S/C14H14FN3O3/c15-11-6-12(18(20)21)10-2-1-4-16-13(10)14(11)17-5-3-9(7-17)8-19/h1-2,4,6,9,19H,3,5,7-8H2 |
| InChIKey | SWOVTPRJRBQKFQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|