About 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine
7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine (PubChem CID 83165018) has the molecular formula C13H9FN4O3
and a molecular weight of 288.24 g/mol. Its IUPAC name is 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine.
Molecular Properties
| Compound Name | 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine |
| PubChem CID | 83165018 |
| Molecular Formula | C13H9FN4O3 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine |
| SMILES | O=[N+]([O-])c1cc(F)c(NCc2ccon2)c2ncccc12 |
| InChI | InChI=1S/C13H9FN4O3/c14-10-6-11(18(19)20)9-2-1-4-15-12(9)13(10)16-7-8-3-5-21-17-8/h1-6,16H,7H2 |
| InChIKey | WKNFBKSVFOJOPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine?
The IUPAC name of 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine (CID 83165018) is 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine.
What is the SMILES notation for 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine?
The canonical SMILES for 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine is O=[N+]([O-])c1cc(F)c(NCc2ccon2)c2ncccc12.
What is the InChIKey of 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine?
The InChIKey is WKNFBKSVFOJOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FN4O3/c14-10-6-11(18(19)20)9-2-1-4-15-12(9)13(10)16-7-8-3-5-21-17-8/h1-6,16H,7H2.
What are the key properties of 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine?
7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine has a molecular weight of 288.24 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-5-nitro-N-(1,2-oxazol-3-ylmethyl)quinolin-8-amine is sourced from PubChem (CID 83165018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).