About 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine
7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine (PubChem CID 83165170) has the molecular formula C13H11FN4O
and a molecular weight of 258.26 g/mol. Its IUPAC name is 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine.
Molecular Properties
| Compound Name | 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine |
| PubChem CID | 83165170 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine |
| SMILES | Nc1cc(F)c(NCc2ccon2)c2ncccc12 |
| InChI | InChI=1S/C13H11FN4O/c14-10-6-11(15)9-2-1-4-16-12(9)13(10)17-7-8-3-5-19-18-8/h1-6,17H,7,15H2 |
| InChIKey | GEMQDXPMLOQINQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine?
The IUPAC name of 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine (CID 83165170) is 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine.
What is the SMILES notation for 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine?
The canonical SMILES for 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine is Nc1cc(F)c(NCc2ccon2)c2ncccc12.
What is the InChIKey of 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine?
The InChIKey is GEMQDXPMLOQINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FN4O/c14-10-6-11(15)9-2-1-4-16-12(9)13(10)17-7-8-3-5-19-18-8/h1-6,17H,7,15H2.
What are the key properties of 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine?
7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine has a molecular weight of 258.26 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-8-N-(1,2-oxazol-3-ylmethyl)quinoline-5,8-diamine is sourced from PubChem (CID 83165170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).