C13H13ClN2O2S — CID 83165921
methyl 2-[5-[[(4-chloro-3-pyridinyl)amino]methyl]thiophen-2-yl]acetate (PubChem CID 83165921) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is methyl 2-[5-[[(4-chloro-3-pyridinyl)amino]methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[[(4-chloro-3-pyridinyl)amino]methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 83165921 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | methyl 2-[5-[[(4-chloro-3-pyridinyl)amino]methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(CNc2cnccc2Cl)s1 |
| InChI | InChI=1S/C13H13ClN2O2S/c1-18-13(17)6-9-2-3-10(19-9)7-16-12-8-15-5-4-11(12)14/h2-5,8,16H,6-7H2,1H3 |
| InChIKey | GTRZSZDZLNKLSK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |