C15H16FN5 — CID 83166357
8-(3,5-diethyl-1,2,4-triazol-1-yl)-7-fluoroquinolin-5-amine (PubChem CID 83166357) has the molecular formula C15H16FN5 and a molecular weight of 285.33 g/mol. Its IUPAC name is 8-(3,5-diethyl-1,2,4-triazol-1-yl)-7-fluoroquinolin-5-amine.
| Compound Name | 8-(3,5-diethyl-1,2,4-triazol-1-yl)-7-fluoroquinolin-5-amine |
|---|---|
| PubChem CID | 83166357 |
| Molecular Formula | C15H16FN5 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 8-(3,5-diethyl-1,2,4-triazol-1-yl)-7-fluoroquinolin-5-amine |
| SMILES | CCc1nc(CC)n(-c2c(F)cc(N)c3cccnc23)n1 |
| InChI | InChI=1S/C15H16FN5/c1-3-12-19-13(4-2)21(20-12)15-10(16)8-11(17)9-6-5-7-18-14(9)15/h5-8H,3-4,17H2,1-2H3 |
| InChIKey | DWORVNILVWXWEZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|