C12H11Br2N3O2S — CID 83167153
4-amino-3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)benzenesulfonamide (PubChem CID 83167153) has the molecular formula C12H11Br2N3O2S and a molecular weight of 421.11 g/mol. Its IUPAC name is 4-amino-3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-amino-3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 83167153 |
| Molecular Formula | C12H11Br2N3O2S |
| Molecular Weight | 421.11 g/mol |
| Exact Mass | 418.89 |
| IUPAC Name | 4-amino-3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)cnc1NS(=O)(=O)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C12H11Br2N3O2S/c1-7-4-8(13)6-16-12(7)17-20(18,19)9-2-3-11(15)10(14)5-9/h2-6H,15H2,1H3,(H,16,17) |
| InChIKey | JJKYBZOOTQISLC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|