C16H20N2 — CID 83167693
4-(2,3,4,5,6-pentamethylphenyl)pyridin-3-amine (PubChem CID 83167693) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentamethylphenyl)pyridin-3-amine.
| Compound Name | 4-(2,3,4,5,6-pentamethylphenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 83167693 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-(2,3,4,5,6-pentamethylphenyl)pyridin-3-amine |
| SMILES | Cc1c(C)c(C)c(-c2ccncc2N)c(C)c1C |
| InChI | InChI=1S/C16H20N2/c1-9-10(2)12(4)16(13(5)11(9)3)14-6-7-18-8-15(14)17/h6-8H,17H2,1-5H3 |
| InChIKey | UPFNNLMTOLCBAE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |