About 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile
1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 83167968) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 83167968 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | CC(C)CCCn1cnc(C#N)n1 |
| InChI | InChI=1S/C9H14N4/c1-8(2)4-3-5-13-7-11-9(6-10)12-13/h7-8H,3-5H2,1-2H3 |
| InChIKey | BLLFETXWAWSBEP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile (CID 83167968) is 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile is CC(C)CCCn1cnc(C#N)n1.
What is the InChIKey of 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile?
The InChIKey is BLLFETXWAWSBEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-8(2)4-3-5-13-7-11-9(6-10)12-13/h7-8H,3-5H2,1-2H3.
What are the key properties of 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile?
1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile has a molecular weight of 178.24 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpentyl)-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 83167968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).