About N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine
N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine (PubChem CID 83168460) has the molecular formula C15H22ClNO3S
and a molecular weight of 331.87 g/mol. Its IUPAC name is N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine |
| PubChem CID | 83168460 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine |
| SMILES | CC1(C)CC(NCc2c(Cl)cccc2S(C)(=O)=O)CCO1 |
| InChI | InChI=1S/C15H22ClNO3S/c1-15(2)9-11(7-8-20-15)17-10-12-13(16)5-4-6-14(12)21(3,18)19/h4-6,11,17H,7-10H2,1-3H3 |
| InChIKey | BMAKRFWXERERNS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine?
The IUPAC name of N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine (CID 83168460) is N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine.
What is the SMILES notation for N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine?
The canonical SMILES for N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine is CC1(C)CC(NCc2c(Cl)cccc2S(C)(=O)=O)CCO1.
What is the InChIKey of N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine?
The InChIKey is BMAKRFWXERERNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClNO3S/c1-15(2)9-11(7-8-20-15)17-10-12-13(16)5-4-6-14(12)21(3,18)19/h4-6,11,17H,7-10H2,1-3H3.
What are the key properties of N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine?
N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine has a molecular weight of 331.87 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-6-methylsulfonylphenyl)methyl]-2,2-dimethyloxan-4-amine is sourced from PubChem (CID 83168460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).