C14H14Cl2N2O2S — CID 83169560
2-chloro-N-[(2-chloro-6-methylsulfonylphenyl)methyl]-4-methylpyridin-3-amine (PubChem CID 83169560) has the molecular formula C14H14Cl2N2O2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 2-chloro-N-[(2-chloro-6-methylsulfonylphenyl)methyl]-4-methylpyridin-3-amine.
| Compound Name | 2-chloro-N-[(2-chloro-6-methylsulfonylphenyl)methyl]-4-methylpyridin-3-amine |
|---|---|
| PubChem CID | 83169560 |
| Molecular Formula | C14H14Cl2N2O2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-chloro-N-[(2-chloro-6-methylsulfonylphenyl)methyl]-4-methylpyridin-3-amine |
| SMILES | Cc1ccnc(Cl)c1NCc1c(Cl)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H14Cl2N2O2S/c1-9-6-7-17-14(16)13(9)18-8-10-11(15)4-3-5-12(10)21(2,19)20/h3-7,18H,8H2,1-2H3 |
| InChIKey | AGEIWLIQABGZRJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|