C14H11BrN2O — CID 83170272
12-bromo-14-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene (PubChem CID 83170272) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is 12-bromo-14-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene.
| Compound Name | 12-bromo-14-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
|---|---|
| PubChem CID | 83170272 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 12-bromo-14-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
| SMILES | Cc1cc(Br)cn2c3c(nc12)-c1ccoc1CC3 |
| InChI | InChI=1S/C14H11BrN2O/c1-8-6-9(15)7-17-11-2-3-12-10(4-5-18-12)13(11)16-14(8)17/h4-7H,2-3H2,1H3 |
| InChIKey | LWAFJAWEXVMJKU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |