About 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine
6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 83170495) has the molecular formula C12H8Br3N3O
and a molecular weight of 449.93 g/mol. Its IUPAC name is 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 83170495 |
| Molecular Formula | C12H8Br3N3O |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 446.82 |
| IUPAC Name | 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1cc(Br)cn2c(N)c(-c3cc(Br)c(Br)o3)nc12 |
| InChI | InChI=1S/C12H8Br3N3O/c1-5-2-6(13)4-18-11(16)9(17-12(5)18)8-3-7(14)10(15)19-8/h2-4H,16H2,1H3 |
| InChIKey | BICYBDVANRJZPF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 56.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine (CID 83170495) is 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine is Cc1cc(Br)cn2c(N)c(-c3cc(Br)c(Br)o3)nc12.
What is the InChIKey of 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is BICYBDVANRJZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Br3N3O/c1-5-2-6(13)4-18-11(16)9(17-12(5)18)8-3-7(14)10(15)19-8/h2-4H,16H2,1H3.
What are the key properties of 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine?
6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 449.93 g/mol, XLogP of 4.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(4,5-dibromofuran-2-yl)-8-methylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 83170495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).