About 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine
6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine (PubChem CID 83170503) has the molecular formula C14H9BrF2N2
and a molecular weight of 323.14 g/mol. Its IUPAC name is 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine |
| PubChem CID | 83170503 |
| Molecular Formula | C14H9BrF2N2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1cc(Br)cn2cc(-c3cc(F)cc(F)c3)nc12 |
| InChI | InChI=1S/C14H9BrF2N2/c1-8-2-10(15)6-19-7-13(18-14(8)19)9-3-11(16)5-12(17)4-9/h2-7H,1H3 |
| InChIKey | KMAZXHGPFSXJAV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine?
The IUPAC name of 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine (CID 83170503) is 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine?
The canonical SMILES for 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine is Cc1cc(Br)cn2cc(-c3cc(F)cc(F)c3)nc12.
What is the InChIKey of 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine?
The InChIKey is KMAZXHGPFSXJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrF2N2/c1-8-2-10(15)6-19-7-13(18-14(8)19)9-3-11(16)5-12(17)4-9/h2-7H,1H3.
What are the key properties of 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine?
6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine has a molecular weight of 323.14 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(3,5-difluorophenyl)-8-methylimidazo[1,2-a]pyridine is sourced from PubChem (CID 83170503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).