About 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone
2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone (PubChem CID 83172715) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone |
| PubChem CID | 83172715 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone |
| SMILES | O=C(Cc1ccco1)c1ncn[nH]1 |
| InChI | InChI=1S/C8H7N3O2/c12-7(8-9-5-10-11-8)4-6-2-1-3-13-6/h1-3,5H,4H2,(H,9,10,11) |
| InChIKey | COLFFUSYCSTJBM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
The IUPAC name of 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone (CID 83172715) is 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone.
What is the SMILES notation for 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
The canonical SMILES for 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone is O=C(Cc1ccco1)c1ncn[nH]1.
What is the InChIKey of 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
The InChIKey is COLFFUSYCSTJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c12-7(8-9-5-10-11-8)4-6-2-1-3-13-6/h1-3,5H,4H2,(H,9,10,11).
What are the key properties of 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone has a molecular weight of 177.16 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone is sourced from PubChem (CID 83172715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).