About 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol
1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol (PubChem CID 83173185) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol |
| PubChem CID | 83173185 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol |
| SMILES | CC1(C)CCC(O)(Cc2ccoc2)C1 |
| InChI | InChI=1S/C12H18O2/c1-11(2)4-5-12(13,9-11)7-10-3-6-14-8-10/h3,6,8,13H,4-5,7,9H2,1-2H3 |
| InChIKey | RPZLKPHJTDWFHE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol?
The IUPAC name of 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol (CID 83173185) is 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol.
What is the SMILES notation for 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol?
The canonical SMILES for 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol is CC1(C)CCC(O)(Cc2ccoc2)C1.
What is the InChIKey of 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol?
The InChIKey is RPZLKPHJTDWFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-11(2)4-5-12(13,9-11)7-10-3-6-14-8-10/h3,6,8,13H,4-5,7,9H2,1-2H3.
What are the key properties of 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol?
1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol has a molecular weight of 194.27 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-ylmethyl)-3,3-dimethylcyclopentan-1-ol is sourced from PubChem (CID 83173185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).