About 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole
4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole (PubChem CID 83173536) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole.
Molecular Properties
| Compound Name | 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole |
| PubChem CID | 83173536 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole |
| SMILES | COc1cccc2c1ccn2Cc1nncn1C |
| InChI | InChI=1S/C13H14N4O/c1-16-9-14-15-13(16)8-17-7-6-10-11(17)4-3-5-12(10)18-2/h3-7,9H,8H2,1-2H3 |
| InChIKey | HVGBLEIVGLEYDM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole?
The IUPAC name of 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole (CID 83173536) is 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole.
What is the SMILES notation for 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole?
The canonical SMILES for 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole is COc1cccc2c1ccn2Cc1nncn1C.
What is the InChIKey of 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole?
The InChIKey is HVGBLEIVGLEYDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O/c1-16-9-14-15-13(16)8-17-7-6-10-11(17)4-3-5-12(10)18-2/h3-7,9H,8H2,1-2H3.
What are the key properties of 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole?
4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole has a molecular weight of 242.28 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]indole is sourced from PubChem (CID 83173536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).