C16H23NO — CID 83174164
1-heptyl-4-methoxyindole (PubChem CID 83174164) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-heptyl-4-methoxyindole.
| Compound Name | 1-heptyl-4-methoxyindole |
|---|---|
| PubChem CID | 83174164 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 1-heptyl-4-methoxyindole |
| SMILES | CCCCCCCn1ccc2c(OC)cccc21 |
| InChI | InChI=1S/C16H23NO/c1-3-4-5-6-7-12-17-13-11-14-15(17)9-8-10-16(14)18-2/h8-11,13H,3-7,12H2,1-2H3 |
| InChIKey | GGASYHGFBXWGDS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|