C16H22N2O2 — CID 83174508
2-(4-ethoxyindol-1-yl)-N,N-diethylacetamide (PubChem CID 83174508) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(4-ethoxyindol-1-yl)-N,N-diethylacetamide.
| Compound Name | 2-(4-ethoxyindol-1-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 83174508 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-(4-ethoxyindol-1-yl)-N,N-diethylacetamide |
| SMILES | CCOc1cccc2c1ccn2CC(=O)N(CC)CC |
| InChI | InChI=1S/C16H22N2O2/c1-4-17(5-2)16(19)12-18-11-10-13-14(18)8-7-9-15(13)20-6-3/h7-11H,4-6,12H2,1-3H3 |
| InChIKey | ITYIBQJOXBJPSL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |