C14H23NO — CID 83176155
1-(4,4-dimethylcyclohexyl)-2-(furan-3-yl)ethanamine (PubChem CID 83176155) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-2-(furan-3-yl)ethanamine.
| Compound Name | 1-(4,4-dimethylcyclohexyl)-2-(furan-3-yl)ethanamine |
|---|---|
| PubChem CID | 83176155 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-2-(furan-3-yl)ethanamine |
| SMILES | CC1(C)CCC(C(N)Cc2ccoc2)CC1 |
| InChI | InChI=1S/C14H23NO/c1-14(2)6-3-12(4-7-14)13(15)9-11-5-8-16-10-11/h5,8,10,12-13H,3-4,6-7,9,15H2,1-2H3 |
| InChIKey | YKIVTGXHVWUSQI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |