C10H22N2O3 — CID 83177784
2-(4-hydroxybutan-2-ylamino)-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 83177784) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(4-hydroxybutan-2-ylamino)-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(4-hydroxybutan-2-ylamino)-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 83177784 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(4-hydroxybutan-2-ylamino)-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CNC(C)CCO |
| InChI | InChI=1S/C10H22N2O3/c1-8(4-5-13)11-6-10(14)12-9(2)7-15-3/h8-9,11,13H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | SBONJCKYXGZGAH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |