C14H28N4O2 — CID 831783
1-N,1-N,4-N,4-N-tetraethylpiperazine-1,4-dicarboxamide (PubChem CID 831783) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetraethylpiperazine-1,4-dicarboxamide.
| Compound Name | 1-N,1-N,4-N,4-N-tetraethylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 831783 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetraethylpiperazine-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C14H28N4O2/c1-5-15(6-2)13(19)17-9-11-18(12-10-17)14(20)16(7-3)8-4/h5-12H2,1-4H3 |
| InChIKey | YVQPNNHLHGFALX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |