C13H18BrNO — CID 83179546
N-(4-bromobutan-2-yl)-2,5-dimethylbenzamide (PubChem CID 83179546) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is N-(4-bromobutan-2-yl)-2,5-dimethylbenzamide.
| Compound Name | N-(4-bromobutan-2-yl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 83179546 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(4-bromobutan-2-yl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NC(C)CCBr)c1 |
| InChI | InChI=1S/C13H18BrNO/c1-9-4-5-10(2)12(8-9)13(16)15-11(3)6-7-14/h4-5,8,11H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | JPFLTQWGFFJJQQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|