C14H21N3O2S — CID 83180321
ethyl 4-methyl-2-[(2-methylthiolan-2-yl)methylamino]pyrimidine-5-carboxylate (PubChem CID 83180321) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(2-methylthiolan-2-yl)methylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(2-methylthiolan-2-yl)methylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 83180321 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl 4-methyl-2-[(2-methylthiolan-2-yl)methylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCC2(C)CCCS2)nc1C |
| InChI | InChI=1S/C14H21N3O2S/c1-4-19-12(18)11-8-15-13(17-10(11)2)16-9-14(3)6-5-7-20-14/h8H,4-7,9H2,1-3H3,(H,15,16,17) |
| InChIKey | SXPNOXVHAGESQC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |