About 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine
3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine (PubChem CID 83180764) has the molecular formula C8H13BrN4
and a molecular weight of 245.12 g/mol. Its IUPAC name is 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine |
| PubChem CID | 83180764 |
| Molecular Formula | C8H13BrN4 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine |
| SMILES | CC(CCN)Nc1ncncc1Br |
| InChI | InChI=1S/C8H13BrN4/c1-6(2-3-10)13-8-7(9)4-11-5-12-8/h4-6H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | IRXBATCERCDZPY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine?
The IUPAC name of 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine (CID 83180764) is 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine.
What is the SMILES notation for 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine?
The canonical SMILES for 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine is CC(CCN)Nc1ncncc1Br.
What is the InChIKey of 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine?
The InChIKey is IRXBATCERCDZPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN4/c1-6(2-3-10)13-8-7(9)4-11-5-12-8/h4-6H,2-3,10H2,1H3,(H,11,12,13).
What are the key properties of 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine?
3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine has a molecular weight of 245.12 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(5-bromopyrimidin-4-yl)butane-1,3-diamine is sourced from PubChem (CID 83180764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).