C13H15ClN4O — CID 831809
1-(3-chlorophenyl)-3-[(1,3-dimethylpyrazol-4-yl)methyl]urea (PubChem CID 831809) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1,3-dimethylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1,3-dimethylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 831809 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1,3-dimethylpyrazol-4-yl)methyl]urea |
| SMILES | Cc1nn(C)cc1CNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClN4O/c1-9-10(8-18(2)17-9)7-15-13(19)16-12-5-3-4-11(14)6-12/h3-6,8H,7H2,1-2H3,(H2,15,16,19) |
| InChIKey | KCXVAUTZGSKSJB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |