C14H15ClO3 — CID 83182538
2-(3-chlorophenyl)-2-(furan-3-ylmethyl)propane-1,3-diol (PubChem CID 83182538) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-(furan-3-ylmethyl)propane-1,3-diol.
| Compound Name | 2-(3-chlorophenyl)-2-(furan-3-ylmethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 83182538 |
| Molecular Formula | C14H15ClO3 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(3-chlorophenyl)-2-(furan-3-ylmethyl)propane-1,3-diol |
| SMILES | OCC(CO)(Cc1ccoc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H15ClO3/c15-13-3-1-2-12(6-13)14(9-16,10-17)7-11-4-5-18-8-11/h1-6,8,16-17H,7,9-10H2 |
| InChIKey | JCBGRUSJIBBFGC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |