C11H18N2O2 — CID 83183147
2-(furan-2-yl)-1-(4-methylmorpholin-2-yl)ethanamine (PubChem CID 83183147) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-(4-methylmorpholin-2-yl)ethanamine.
| Compound Name | 2-(furan-2-yl)-1-(4-methylmorpholin-2-yl)ethanamine |
|---|---|
| PubChem CID | 83183147 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(furan-2-yl)-1-(4-methylmorpholin-2-yl)ethanamine |
| SMILES | CN1CCOC(C(N)Cc2ccco2)C1 |
| InChI | InChI=1S/C11H18N2O2/c1-13-4-6-15-11(8-13)10(12)7-9-3-2-5-14-9/h2-3,5,10-11H,4,6-8,12H2,1H3 |
| InChIKey | YWQHMQLFRKGVFG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |