C12H18F3NO — CID 83183463
5,5,5-trifluoro-1-(furan-2-yl)-N-propylpentan-2-amine (PubChem CID 83183463) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(furan-2-yl)-N-propylpentan-2-amine.
| Compound Name | 5,5,5-trifluoro-1-(furan-2-yl)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 83183463 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 5,5,5-trifluoro-1-(furan-2-yl)-N-propylpentan-2-amine |
| SMILES | CCCNC(CCC(F)(F)F)Cc1ccco1 |
| InChI | InChI=1S/C12H18F3NO/c1-2-7-16-10(5-6-12(13,14)15)9-11-4-3-8-17-11/h3-4,8,10,16H,2,5-7,9H2,1H3 |
| InChIKey | MBFVRDLPBAIKOL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |