About [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol
[4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol (PubChem CID 83184895) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol.
Molecular Properties
| Compound Name | [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol |
| PubChem CID | 83184895 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol |
| SMILES | Cc1nc(N2CCCOC(C)C2)ncc1CO |
| InChI | InChI=1S/C12H19N3O2/c1-9-7-15(4-3-5-17-9)12-13-6-11(8-16)10(2)14-12/h6,9,16H,3-5,7-8H2,1-2H3 |
| InChIKey | AIDKTQVLCLWNIN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol?
The IUPAC name of [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol (CID 83184895) is [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol.
What is the SMILES notation for [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol?
The canonical SMILES for [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol is Cc1nc(N2CCCOC(C)C2)ncc1CO.
What is the InChIKey of [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol?
The InChIKey is AIDKTQVLCLWNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-9-7-15(4-3-5-17-9)12-13-6-11(8-16)10(2)14-12/h6,9,16H,3-5,7-8H2,1-2H3.
What are the key properties of [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol?
[4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol has a molecular weight of 237.30 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-5-yl]methanol is sourced from PubChem (CID 83184895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).