About [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine
[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine (PubChem CID 83185118) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine |
| PubChem CID | 83185118 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine |
| SMILES | Cc1nc(N2CCCC2(C)C)ncc1CN |
| InChI | InChI=1S/C12H20N4/c1-9-10(7-13)8-14-11(15-9)16-6-4-5-12(16,2)3/h8H,4-7,13H2,1-3H3 |
| InChIKey | QXKOWGLBSROLAY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine?
The IUPAC name of [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine (CID 83185118) is [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine.
What is the SMILES notation for [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine?
The canonical SMILES for [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine is Cc1nc(N2CCCC2(C)C)ncc1CN.
What is the InChIKey of [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine?
The InChIKey is QXKOWGLBSROLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c1-9-10(7-13)8-14-11(15-9)16-6-4-5-12(16,2)3/h8H,4-7,13H2,1-3H3.
What are the key properties of [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine?
[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine has a molecular weight of 220.32 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methanamine is sourced from PubChem (CID 83185118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).