About 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea
1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea (PubChem CID 831861) has the molecular formula C14H16ClN5O2
and a molecular weight of 321.77 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea.
Molecular Properties
| Compound Name | 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea |
| PubChem CID | 831861 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NNC(=O)c2c(Cl)c(C)nn2C)c1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-8-5-4-6-10(7-8)16-14(22)18-17-13(21)12-11(15)9(2)19-20(12)3/h4-7H,1-3H3,(H,17,21)(H2,16,18,22) |
| InChIKey | UWSLZAMQUONYLK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea?
The IUPAC name of 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea (CID 831861) is 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea.
What is the SMILES notation for 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea?
The canonical SMILES for 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea is Cc1cccc(NC(=O)NNC(=O)c2c(Cl)c(C)nn2C)c1.
What is the InChIKey of 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea?
The InChIKey is UWSLZAMQUONYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN5O2/c1-8-5-4-6-10(7-8)16-14(22)18-17-13(21)12-11(15)9(2)19-20(12)3/h4-7H,1-3H3,(H,17,21)(H2,16,18,22).
What are the key properties of 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea?
1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea has a molecular weight of 321.77 g/mol, XLogP of 2.16, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(3-methylphenyl)urea is sourced from PubChem (CID 831861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).