C12H17BrClNO — CID 83186503
N-[(2-bromo-5-methoxyphenyl)methyl]-4-chlorobutan-2-amine (PubChem CID 83186503) has the molecular formula C12H17BrClNO and a molecular weight of 306.63 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxyphenyl)methyl]-4-chlorobutan-2-amine.
| Compound Name | N-[(2-bromo-5-methoxyphenyl)methyl]-4-chlorobutan-2-amine |
|---|---|
| PubChem CID | 83186503 |
| Molecular Formula | C12H17BrClNO |
| Molecular Weight | 306.63 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N-[(2-bromo-5-methoxyphenyl)methyl]-4-chlorobutan-2-amine |
| SMILES | COc1ccc(Br)c(CNC(C)CCCl)c1 |
| InChI | InChI=1S/C12H17BrClNO/c1-9(5-6-14)15-8-10-7-11(16-2)3-4-12(10)13/h3-4,7,9,15H,5-6,8H2,1-2H3 |
| InChIKey | NTZGXYLZLNYRQP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|