C11H11F3N2S — CID 83186722
4-methyl-N-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 83186722) has the molecular formula C11H11F3N2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 4-methyl-N-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | 4-methyl-N-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 83186722 |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-methyl-N-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CC1CCSC(Nc2cc(F)c(F)cc2F)=N1 |
| InChI | InChI=1S/C11H11F3N2S/c1-6-2-3-17-11(15-6)16-10-5-8(13)7(12)4-9(10)14/h4-6H,2-3H2,1H3,(H,15,16) |
| InChIKey | QCTNVZQJKRXRTI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|