About 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile
2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile (PubChem CID 83186977) has the molecular formula C12H12FN3S
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile |
| PubChem CID | 83186977 |
| Molecular Formula | C12H12FN3S |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile |
| SMILES | CC1CCSC(Nc2ccc(F)c(C#N)c2)=N1 |
| InChI | InChI=1S/C12H12FN3S/c1-8-4-5-17-12(15-8)16-10-2-3-11(13)9(6-10)7-14/h2-3,6,8H,4-5H2,1H3,(H,15,16) |
| InChIKey | HYBPEQQXKGBJFA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile?
The IUPAC name of 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile (CID 83186977) is 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile.
What is the SMILES notation for 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile?
The canonical SMILES for 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile is CC1CCSC(Nc2ccc(F)c(C#N)c2)=N1.
What is the InChIKey of 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile?
The InChIKey is HYBPEQQXKGBJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3S/c1-8-4-5-17-12(15-8)16-10-2-3-11(13)9(6-10)7-14/h2-3,6,8H,4-5H2,1H3,(H,15,16).
What are the key properties of 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile?
2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile has a molecular weight of 249.31 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-[(4-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzonitrile is sourced from PubChem (CID 83186977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).