C10H17Br2N3 — CID 83187571
4-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]butan-2-amine (PubChem CID 83187571) has the molecular formula C10H17Br2N3 and a molecular weight of 339.08 g/mol. Its IUPAC name is 4-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]butan-2-amine.
| Compound Name | 4-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 83187571 |
| Molecular Formula | C10H17Br2N3 |
| Molecular Weight | 339.08 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 4-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]butan-2-amine |
| SMILES | Cc1nn(C)c(CNC(C)CCBr)c1Br |
| InChI | InChI=1S/C10H17Br2N3/c1-7(4-5-11)13-6-9-10(12)8(2)14-15(9)3/h7,13H,4-6H2,1-3H3 |
| InChIKey | NITXRHICPCFUPL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|