C12H22BrN3 — CID 83188395
4-bromo-N-[(1-butan-2-ylpyrazol-3-yl)methyl]butan-2-amine (PubChem CID 83188395) has the molecular formula C12H22BrN3 and a molecular weight of 288.23 g/mol. Its IUPAC name is 4-bromo-N-[(1-butan-2-ylpyrazol-3-yl)methyl]butan-2-amine.
| Compound Name | 4-bromo-N-[(1-butan-2-ylpyrazol-3-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 83188395 |
| Molecular Formula | C12H22BrN3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-bromo-N-[(1-butan-2-ylpyrazol-3-yl)methyl]butan-2-amine |
| SMILES | CCC(C)n1ccc(CNC(C)CCBr)n1 |
| InChI | InChI=1S/C12H22BrN3/c1-4-11(3)16-8-6-12(15-16)9-14-10(2)5-7-13/h6,8,10-11,14H,4-5,7,9H2,1-3H3 |
| InChIKey | PSPLRQBCYGNEOK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|