C14H22N4 — CID 83188721
[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylpyrimidin-5-yl]methanamine (PubChem CID 83188721) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylpyrimidin-5-yl]methanamine.
| Compound Name | [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylpyrimidin-5-yl]methanamine |
|---|---|
| PubChem CID | 83188721 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylpyrimidin-5-yl]methanamine |
| SMILES | Cc1nc(N2CCC3CCCCC32)ncc1CN |
| InChI | InChI=1S/C14H22N4/c1-10-12(8-15)9-16-14(17-10)18-7-6-11-4-2-3-5-13(11)18/h9,11,13H,2-8,15H2,1H3 |
| InChIKey | WMOKVFOCXHQFMF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |