C12H17F4N3O — CID 83189356
N-[[4-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyrimidin-5-yl]methyl]propan-2-amine (PubChem CID 83189356) has the molecular formula C12H17F4N3O and a molecular weight of 295.28 g/mol. Its IUPAC name is N-[[4-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyrimidin-5-yl]methyl]propan-2-amine.
| Compound Name | N-[[4-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyrimidin-5-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 83189356 |
| Molecular Formula | C12H17F4N3O |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[[4-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyrimidin-5-yl]methyl]propan-2-amine |
| SMILES | Cc1nc(OCC(F)(F)C(F)F)ncc1CNC(C)C |
| InChI | InChI=1S/C12H17F4N3O/c1-7(2)17-4-9-5-18-11(19-8(9)3)20-6-12(15,16)10(13)14/h5,7,10,17H,4,6H2,1-3H3 |
| InChIKey | TVXVLUILZXNVOO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|