About 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine
2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 83190972) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| PubChem CID | 83190972 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | CCc1nc(N)c2c(n1)CSC2 |
| InChI | InChI=1S/C8H11N3S/c1-2-7-10-6-4-12-3-5(6)8(9)11-7/h2-4H2,1H3,(H2,9,10,11) |
| InChIKey | PNTROVYJSKWAOO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The IUPAC name of 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (CID 83190972) is 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine is CCc1nc(N)c2c(n1)CSC2.
What is the InChIKey of 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The InChIKey is PNTROVYJSKWAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-2-7-10-6-4-12-3-5(6)8(9)11-7/h2-4H2,1H3,(H2,9,10,11).
What are the key properties of 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine has a molecular weight of 181.26 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 83190972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).