About 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine
2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 83191581) has the molecular formula C13H12ClN3S
and a molecular weight of 277.78 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| PubChem CID | 83191581 |
| Molecular Formula | C13H12ClN3S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(Cc2ccc(Cl)cc2)nc2c1CSC2 |
| InChI | InChI=1S/C13H12ClN3S/c14-9-3-1-8(2-4-9)5-12-16-11-7-18-6-10(11)13(15)17-12/h1-4H,5-7H2,(H2,15,16,17) |
| InChIKey | LRTGQXNFQKXHOO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The IUPAC name of 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (CID 83191581) is 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine is Nc1nc(Cc2ccc(Cl)cc2)nc2c1CSC2.
What is the InChIKey of 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The InChIKey is LRTGQXNFQKXHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3S/c14-9-3-1-8(2-4-9)5-12-16-11-7-18-6-10(11)13(15)17-12/h1-4H,5-7H2,(H2,15,16,17).
What are the key properties of 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine has a molecular weight of 277.78 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methyl]-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 83191581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).