C9H16N2O4 — CID 83191607
N,N-bis(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 83191607) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 83191607 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)N(CCO)CCO)CN1 |
| InChI | InChI=1S/C9H16N2O4/c12-3-1-11(2-4-13)9(15)7-5-8(14)10-6-7/h7,12-13H,1-6H2,(H,10,14) |
| InChIKey | ZLBODIPHKWMZNR-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |