C13H12N4O2S — CID 83191661
[2-(1,3-benzodioxol-5-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 83191661) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 83191661 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc3c(c2)OCO3)nc2c1CSC2 |
| InChI | InChI=1S/C13H12N4O2S/c14-17-13-8-4-20-5-9(8)15-12(16-13)7-1-2-10-11(3-7)19-6-18-10/h1-3H,4-6,14H2,(H,15,16,17) |
| InChIKey | RURGPVOWEJSJQK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|