About N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 83192047) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide |
| PubChem CID | 83192047 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Nc1ccc2c(c1)CCC2NC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C14H17N3O2/c15-10-2-3-11-8(5-10)1-4-12(11)17-14(19)9-6-13(18)16-7-9/h2-3,5,9,12H,1,4,6-7,15H2,(H,16,18)(H,17,19) |
| InChIKey | XWSDRAJPQIGOHJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide?
The IUPAC name of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide (CID 83192047) is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide.
What is the SMILES notation for N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide?
The canonical SMILES for N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide is Nc1ccc2c(c1)CCC2NC(=O)C1CNC(=O)C1.
What is the InChIKey of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide?
The InChIKey is XWSDRAJPQIGOHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c15-10-2-3-11-8(5-10)1-4-12(11)17-14(19)9-6-13(18)16-7-9/h2-3,5,9,12H,1,4,6-7,15H2,(H,16,18)(H,17,19).
What are the key properties of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide?
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide has a molecular weight of 259.31 g/mol, XLogP of 0.51, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidine-3-carboxamide is sourced from PubChem (CID 83192047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).