C9H11N3O4 — CID 83193614
4-(5-oxopyrrolidine-3-carbonyl)piperazine-2,6-dione (PubChem CID 83193614) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is 4-(5-oxopyrrolidine-3-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(5-oxopyrrolidine-3-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 83193614 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4-(5-oxopyrrolidine-3-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CC(C(=O)N2CC(=O)NC(=O)C2)CN1 |
| InChI | InChI=1S/C9H11N3O4/c13-6-1-5(2-10-6)9(16)12-3-7(14)11-8(15)4-12/h5H,1-4H2,(H,10,13)(H,11,14,15) |
| InChIKey | YMJUMQGZKVMFBP-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|