About (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid
(2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid (PubChem CID 83194398) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid.
Analyze (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid?
The IUPAC name of (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid (CID 83194398) is (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid.
What is the SMILES notation for (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid?
The canonical SMILES for (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid is Cc1cc(CN[C@@H](C)C(=O)O)n(C)n1.
What is the InChIKey of (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid?
The InChIKey is QXMYVJDVNOGZFB-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-6-4-8(12(3)11-6)5-10-7(2)9(13)14/h4,7,10H,5H2,1-3H3,(H,13,14)/t7-/m0/s1.
What are the key properties of (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid?
(2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid has a molecular weight of 197.24 g/mol, XLogP of 0.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2,5-dimethylpyrazol-3-yl)methylamino]propanoic acid is sourced from PubChem (CID 83194398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).