C13H14BrN3O — CID 83195620
[2-[(2-bromophenyl)methoxy]-4-methylpyrimidin-5-yl]methanamine (PubChem CID 83195620) has the molecular formula C13H14BrN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methoxy]-4-methylpyrimidin-5-yl]methanamine.
| Compound Name | [2-[(2-bromophenyl)methoxy]-4-methylpyrimidin-5-yl]methanamine |
|---|---|
| PubChem CID | 83195620 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | [2-[(2-bromophenyl)methoxy]-4-methylpyrimidin-5-yl]methanamine |
| SMILES | Cc1nc(OCc2ccccc2Br)ncc1CN |
| InChI | InChI=1S/C13H14BrN3O/c1-9-11(6-15)7-16-13(17-9)18-8-10-4-2-3-5-12(10)14/h2-5,7H,6,8,15H2,1H3 |
| InChIKey | NLHJAGQITAVMPL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |